![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| StudyAbroad2021.pdf | 2024-12-20 19:00 | 3.8M | |
| School of Nursing202..> | 2024-12-20 19:00 | 4.0M | |
| School of Graduate S..> | 2024-12-20 19:00 | 3.3M | |
| School of Graduate S..> | 2024-12-20 19:00 | 3.5M | |
| School of Fine Art20..> | 2024-12-20 19:00 | 5.2M | |
| SSB2021.pdf | 2024-12-20 19:00 | 5.1M | |
| Psychology2021.pdf | 2024-12-20 19:00 | 4.3M | |
| Politics Law Societ..> | 2024-12-20 19:00 | 5.2M | |
| Politics Law & Socie..> | 2024-12-20 19:00 | 5.2M | |
| Physics2021.pdf | 2024-12-20 19:00 | 4.8M | |
| PerformingArts2021.pdf | 2024-12-20 19:00 | 5.7M | |
| NAS2021.pdf | 2024-12-20 19:00 | 4.3M | |
| Molecular Bio2021.pdf | 2024-12-20 19:00 | 4.7M | |
| Medical Botany2021.pdf | 2024-12-20 19:00 | 6.8M | |
| MathCS2021.pdf | 2024-12-20 19:00 | 3.9M | |
| Kinesiology 2021.pdf | 2024-12-20 19:00 | 4.5M | |
| Interdisciplinary St..> | 2024-12-20 19:00 | 4.3M | |
| IMG_9810.jpg | 2024-12-20 19:00 | 87K | |
| IMG_3144_0.jpg | 2024-12-20 19:00 | 203K | |
| IMG_3144.jpg | 2024-12-20 19:00 | 203K | |
| IMG_1642.JPG | 2024-12-20 19:00 | 7.7M | |
| History2021.pdf | 2024-12-20 19:00 | 4.5M | |
| HS- Social Work2021.pdf | 2024-12-20 19:00 | 4.2M | |
| HS-Services to the D..> | 2024-12-20 19:00 | 3.8M | |
| HS-RehabServices2021..> | 2024-12-20 19:00 | 4.0M | |
| HS-Human Services 20..> | 2024-12-20 19:00 | 4.0M | |
| HS-HumanServiceCouns..> | 2024-12-20 19:00 | 4.2M | |
| HS-Criminal Justice ..> | 2024-12-20 19:00 | 5.7M | |
| HS-AgingServices2021..> | 2024-12-20 19:00 | 4.0M | |
| EngLang2021.pdf | 2024-12-20 19:00 | 3.8M | |
| Education2021.pdf | 2024-12-20 19:00 | 5.3M | |
| Ecology2021.pdf | 2024-12-20 19:00 | 4.6M | |
| EHS2021.pdf | 2024-12-20 19:00 | 3.9M | |
| Chemistry2021.pdf | 2024-12-20 19:00 | 4.3M | |
| COP2021.pdf | 2024-12-20 19:00 | 4.7M | |
| CLASS combined2021.pdf | 2024-12-20 19:00 | 3.7M | |
| CLASS.pdf | 2025-05-15 13:44 | 2.0M | |
| CHS2021.pdf | 2024-12-20 19:00 | 3.7M | |
| CEP2021.pdf | 2024-12-20 19:00 | 3.6M | |
| Bus Adm2021.pdf | 2024-12-20 19:00 | 4.1M | |
| Bus. Adm.2021.pdf | 2024-12-20 19:00 | 4.1M | |
| Brochure Pictures/ | 2024-04-10 10:50 | - | |
| Biology2021.pdf | 2024-12-20 19:00 | 4.6M | |
| Accounting2021.pdf | 2024-12-20 19:00 | 4.9M | |
| ADMC2021.pdf | 2024-12-20 19:00 | 5.3M | |